What is the composition of montmorillonite KSF clay?
Montmorillonite Mineral Data
| General Montmorillonite Information | |
|---|---|
| Chemical Formula: | (Na,Ca)0,3(Al,Mg)2Si4O10(OH)2•n(H2O) |
| 100.00 % 100.58 % = TOTAL OXIDE | |
| Empirical Formula: | Na0.2Ca0.1Al2Si4O10(OH)2(H2O)10 |
| IMA Status: | Valid Species (Pre-IMA) 1847 |
What is the chemical composition of montmorillonite?
Montmorillonite/smectite This family usually comprises nonmetallic clays primarily with a chemical composition of hydrated sodium calcium aluminum silicate, a group of monoclinic clay-like minerals with the general formula (Ca, Na, H) (Al, Mg, Fe, Zn)2(Si, Al)4O10(OH)2·nH2O.
What is montmorillonite KSF?
Abstract. Montmorillonite K-10 and KSF are highly efficient catalysts for the acetylation of a variety of alcohols, thiols, phenols and amines with acetic anhydride.
What are the characteristics of montmorillonite?
Figure 1.
| S. no | Property name | Description |
|---|---|---|
| 1. | Density | 2–3 g/cm3 (measured) |
| 2. | Crystal system | Monoclinic |
| 3. | Hardness | 1–2 on Mohs scale, soft, possess fine-grained occurrence |
| 4. | Fracture | Irregular, uneven |
How montmorillonite is formed?
Montmorillonite is formed by the weathering of volcanic ash and it is likely to have been present on the Early Earth, because it is believed that there were high levels of volcanic activity. Today, there are large deposits of montmorillonite on the Earth and it has recently been detected on Mars (Poulet et al. 2005).
What is the use of montmorillonite clay?
It is also used as a component of foundry sand and as a desiccant to remove moisture from air and gases. Montmorillonite clays have been extensively used in catalytic processes. Cracking catalysts have used montmorillonite clays for over 60 years. Other acid-based catalysts use acid-treated montmorillonite clays.
How do you say montmorillonite?
Phonetic spelling of montmorillonite
- mont-mo-ril-lonite.
- mont-mo-ril-lonite. Thurman Luettgen.
- mont-mor-il-lon-ite. Valentina Harris.
What kind of mineral is montmorillonite?
phyllosilicate
Montmorillonite is a very soft phyllosilicate group of minerals that form when they precipitate from water solution as microscopic crystals, known as clay.
What type of rock is montmorillonite?
clay
Montmorillonite is a very soft phyllosilicate group of minerals that form when they precipitate from water solution as microscopic crystals, known as clay. It is named after Montmorillon in France.
Why montmorillonite is an expansive clay?
Montmorillonites expand considerably more than other clays due to water penetrating the interlayer molecular spaces and concomitant adsorption. The amount of expansion is due largely to the type of exchangeable cation contained in the sample.
What is the water content of montmorillonite?
The water content of montmorillonite is variable and it increases greatly in volume when it absorbs water. Chemically, it is hydrated sodium calcium aluminium magnesium silicate hydroxide (Na,Ca)0.33(Al,Mg)2(Si4O10) (OH)2·nH2O.
How is montmorillonite formed?
Montmorillonite can be concentrated and transformed within cave environments. The natural weathering of the cave can leave behind concentrations of aluminosilicates which were contained within the bedrock. Montmorillonite can form slowly in solutions of aluminosilicates.
What is sodium montmorillonite used for?
Hence, sodium montmorillonite has come to be used as the major constituent in nonexplosive agents for splitting rock in natural stone quarries in an effort to limit the amount of waste, or for the demolition of concrete structures where the use of explosive charges is unacceptable.
What is the difference between beidellite and montmorillonite?
In contrast, beidellite is smectite with greater than 50% tetrahedral charge originating from isomorphous substitution of Al for Si in the silica sheet. The individual crystals of montmorillonite clay are not tightly bound hence water can intervene, causing the clay to swell.